C17H26Cl2N2 — CID 64838193
1-[(2,6-dichlorophenyl)methyl]-2-propan-2-yl-5-propylpiperazine (PubChem CID 64838193) has the molecular formula C17H26Cl2N2 and a molecular weight of 329.31 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-2-propan-2-yl-5-propylpiperazine.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-2-propan-2-yl-5-propylpiperazine |
|---|---|
| PubChem CID | 64838193 |
| Molecular Formula | C17H26Cl2N2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-2-propan-2-yl-5-propylpiperazine |
| SMILES | CCCC1CN(Cc2c(Cl)cccc2Cl)C(C(C)C)CN1 |
| InChI | InChI=1S/C17H26Cl2N2/c1-4-6-13-10-21(17(9-20-13)12(2)3)11-14-15(18)7-5-8-16(14)19/h5,7-8,12-13,17,20H,4,6,9-11H2,1-3H3 |
| InChIKey | FOVMOKNOXPQPDZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |