About 2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate
2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate (PubChem CID 146675976) has the molecular formula C8H18NO7P
and a molecular weight of 271.21 g/mol. Its IUPAC name is 2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate.
Molecular Properties
| Compound Name | 2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate |
| PubChem CID | 146675976 |
| Molecular Formula | C8H18NO7P |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate |
| SMILES | CCOP(=O)(CC[NH3+])OCC.O=C([O-])C(=O)O |
| InChI | InChI=1S/C6H16NO3P.C2H2O4/c1-3-9-11(8,6-5-7)10-4-2;3-1(4)2(5)6/h3-7H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | YWTBOEJNYKHJGI-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 140.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate?
The IUPAC name of 2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate (CID 146675976) is 2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate.
What is the SMILES notation for 2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate?
The canonical SMILES for 2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate is CCOP(=O)(CC[NH3+])OCC.O=C([O-])C(=O)O.
What is the InChIKey of 2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate?
The InChIKey is YWTBOEJNYKHJGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16NO3P.C2H2O4/c1-3-9-11(8,6-5-7)10-4-2;3-1(4)2(5)6/h3-7H2,1-2H3;(H,3,4)(H,5,6).
What are the key properties of 2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate?
2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate has a molecular weight of 271.21 g/mol, XLogP of -1.68, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diethoxyphosphorylethylazanium;2-hydroxy-2-oxoacetate is sourced from PubChem (CID 146675976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).