C28H26F2N4O2 — CID 146676575
(NE)-N-[[2-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methoxyphenyl)quinolin-6-yl]-6-fluorophenyl]methylidene]hydroxylamine (PubChem CID 146676575) has the molecular formula C28H26F2N4O2 and a molecular weight of 488.54 g/mol. Its IUPAC name is (NE)-N-[[2-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methoxyphenyl)quinolin-6-yl]-6-fluorophenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[2-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methoxyphenyl)quinolin-6-yl]-6-fluorophenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 146676575 |
| Molecular Formula | C28H26F2N4O2 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | (NE)-N-[[2-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methoxyphenyl)quinolin-6-yl]-6-fluorophenyl]methylidene]hydroxylamine |
| SMILES | COc1cc(F)cc(-c2cnc3ccc(-c4cccc(F)c4/C=N/O)cc3c2N2CCC(N)CC2)c1 |
| InChI | InChI=1S/C28H26F2N4O2/c1-36-21-12-18(11-19(29)14-21)24-15-32-27-6-5-17(22-3-2-4-26(30)25(22)16-33-35)13-23(27)28(24)34-9-7-20(31)8-10-34/h2-6,11-16,20,35H,7-10,31H2,1H3/b33-16+ |
| InChIKey | MFXJWJYASCWNOL-MHDJOFBISA-N |
| XLogP | 5.59 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|