C19H28N2O2 — CID 146680933
4-ethyl-N-[(2S)-4-methyl-1-oxo-1-pyrrolidin-1-ylpentan-2-yl]benzamide (PubChem CID 146680933) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 4-ethyl-N-[(2S)-4-methyl-1-oxo-1-pyrrolidin-1-ylpentan-2-yl]benzamide.
| Compound Name | 4-ethyl-N-[(2S)-4-methyl-1-oxo-1-pyrrolidin-1-ylpentan-2-yl]benzamide |
|---|---|
| PubChem CID | 146680933 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 4-ethyl-N-[(2S)-4-methyl-1-oxo-1-pyrrolidin-1-ylpentan-2-yl]benzamide |
| SMILES | CCc1ccc(C(=O)N[C@@H](CC(C)C)C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H28N2O2/c1-4-15-7-9-16(10-8-15)18(22)20-17(13-14(2)3)19(23)21-11-5-6-12-21/h7-10,14,17H,4-6,11-13H2,1-3H3,(H,20,22)/t17-/m0/s1 |
| InChIKey | BNDMVFTVBINJLL-KRWDZBQOSA-N |
| XLogP | 3.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |