C18H16N5NaO3S2 — CID 146681619
sodium N-[4-[[1-[(dimethylamino)methyl]-5-nitro-2-oxoindol-3-ylidene]amino]phenyl]carbamodithioate (PubChem CID 146681619) has the molecular formula C18H16N5NaO3S2 and a molecular weight of 437.48 g/mol. Its IUPAC name is sodium N-[4-[[1-[(dimethylamino)methyl]-5-nitro-2-oxoindol-3-ylidene]amino]phenyl]carbamodithioate.
| Compound Name | sodium N-[4-[[1-[(dimethylamino)methyl]-5-nitro-2-oxoindol-3-ylidene]amino]phenyl]carbamodithioate |
|---|---|
| PubChem CID | 146681619 |
| Molecular Formula | C18H16N5NaO3S2 |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | sodium N-[4-[[1-[(dimethylamino)methyl]-5-nitro-2-oxoindol-3-ylidene]amino]phenyl]carbamodithioate |
| SMILES | CN(C)CN1C(=O)/C(=N\c2ccc(NC(=S)[S-])cc2)c2cc([N+](=O)[O-])ccc21.[Na+] |
| InChI | InChI=1S/C18H17N5O3S2.Na/c1-21(2)10-22-15-8-7-13(23(25)26)9-14(15)16(17(22)24)19-11-3-5-12(6-4-11)20-18(27)28;/h3-9H,10H2,1-2H3,(H2,20,27,28);/q;+1/p-1/b19-16-; |
| InChIKey | BUJVRNYWTDOPPX-JWJVXZKMSA-M |
| XLogP | -0.17 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|