C26H25N7O3S — CID 146681681
1-[4-[[1-[(dimethylamino)methyl]-5-nitro-2-oxoindol-3-ylidene]amino]phenyl]-3-[(3-methylphenyl)methylideneamino]thiourea (PubChem CID 146681681) has the molecular formula C26H25N7O3S and a molecular weight of 515.60 g/mol. Its IUPAC name is 1-[4-[[1-[(dimethylamino)methyl]-5-nitro-2-oxoindol-3-ylidene]amino]phenyl]-3-[(3-methylphenyl)methylideneamino]thiourea.
| Compound Name | 1-[4-[[1-[(dimethylamino)methyl]-5-nitro-2-oxoindol-3-ylidene]amino]phenyl]-3-[(3-methylphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 146681681 |
| Molecular Formula | C26H25N7O3S |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 1-[4-[[1-[(dimethylamino)methyl]-5-nitro-2-oxoindol-3-ylidene]amino]phenyl]-3-[(3-methylphenyl)methylideneamino]thiourea |
| SMILES | Cc1cccc(C=NNC(=S)Nc2ccc(/N=C3\C(=O)N(CN(C)C)c4ccc([N+](=O)[O-])cc43)cc2)c1 |
| InChI | InChI=1S/C26H25N7O3S/c1-17-5-4-6-18(13-17)15-27-30-26(37)29-20-9-7-19(8-10-20)28-24-22-14-21(33(35)36)11-12-23(22)32(25(24)34)16-31(2)3/h4-15H,16H2,1-3H3,(H2,29,30,37)/b27-15?,28-24- |
| InChIKey | CXFLJENFPZAWLW-FOMGGBCHSA-N |
| XLogP | 4.21 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|