C47H34N2O10 — CID 146681737
2-[5-[4-[[4-[2-(1-carboxyethyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]-diphenylmethyl]phenoxy]-1,3-dioxoisoindol-2-yl]propanoic acid (PubChem CID 146681737) has the molecular formula C47H34N2O10 and a molecular weight of 786.79 g/mol. Its IUPAC name is 2-[5-[4-[[4-[2-(1-carboxyethyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]-diphenylmethyl]phenoxy]-1,3-dioxoisoindol-2-yl]propanoic acid.
| Compound Name | 2-[5-[4-[[4-[2-(1-carboxyethyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]-diphenylmethyl]phenoxy]-1,3-dioxoisoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 146681737 |
| Molecular Formula | C47H34N2O10 |
| Molecular Weight | 786.79 g/mol |
| Exact Mass | 786.22 |
| IUPAC Name | 2-[5-[4-[[4-[2-(1-carboxyethyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]-diphenylmethyl]phenoxy]-1,3-dioxoisoindol-2-yl]propanoic acid |
| SMILES | CC(C(=O)O)N1C(=O)c2ccc(Oc3ccc(C(c4ccccc4)(c4ccccc4)c4ccc(Oc5ccc6c(c5)C(=O)N(C(C)C(=O)O)C6=O)cc4)cc3)cc2C1=O |
| InChI | InChI=1S/C47H34N2O10/c1-27(45(54)55)48-41(50)37-23-21-35(25-39(37)43(48)52)58-33-17-13-31(14-18-33)47(29-9-5-3-6-10-29,30-11-7-4-8-12-30)32-15-19-34(20-16-32)59-36-22-24-38-40(26-36)44(53)49(42(38)51)28(2)46(56)57/h3-28H,1-2H3,(H,54,55)(H,56,57) |
| InChIKey | IYWDRKCYYPZOJK-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 167.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.79 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|