C11H18O3 — CID 146682499
(3R,4R,5S,6S)-6-[(E)-but-2-en-2-yl]-4-hydroxy-3,5-dimethyloxan-2-one (PubChem CID 146682499) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (3R,4R,5S,6S)-6-[(E)-but-2-en-2-yl]-4-hydroxy-3,5-dimethyloxan-2-one.
| Compound Name | (3R,4R,5S,6S)-6-[(E)-but-2-en-2-yl]-4-hydroxy-3,5-dimethyloxan-2-one |
|---|---|
| PubChem CID | 146682499 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (3R,4R,5S,6S)-6-[(E)-but-2-en-2-yl]-4-hydroxy-3,5-dimethyloxan-2-one |
| SMILES | C/C=C(\C)[C@H]1OC(=O)[C@H](C)[C@H](O)[C@@H]1C |
| InChI | InChI=1S/C11H18O3/c1-5-6(2)10-7(3)9(12)8(4)11(13)14-10/h5,7-10,12H,1-4H3/b6-5+/t7-,8+,9+,10+/m0/s1 |
| InChIKey | LYBYCXLXPCHGPC-TYTKGTHBSA-N |
| XLogP | 1.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|