About 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione
1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione (PubChem CID 146682899) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione.
Molecular Properties
| Compound Name | 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione |
| PubChem CID | 146682899 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione |
| SMILES | CC(C)C=C1C(=O)NC(=O)C(=O)N1C |
| InChI | InChI=1S/C9H12N2O3/c1-5(2)4-6-7(12)10-8(13)9(14)11(6)3/h4-5H,1-3H3,(H,10,12,13) |
| InChIKey | ILNIEDZGKQKWNQ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione?
The IUPAC name of 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione (CID 146682899) is 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione.
What is the SMILES notation for 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione?
The canonical SMILES for 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione is CC(C)C=C1C(=O)NC(=O)C(=O)N1C.
What is the InChIKey of 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione?
The InChIKey is ILNIEDZGKQKWNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-5(2)4-6-7(12)10-8(13)9(14)11(6)3/h4-5H,1-3H3,(H,10,12,13).
What are the key properties of 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione?
1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione has a molecular weight of 196.21 g/mol, XLogP of -0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione is sourced from PubChem (CID 146682899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).