C9H12N2O3 — CID 146682899
1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione (PubChem CID 146682899) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione.
| Compound Name | 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione |
|---|---|
| PubChem CID | 146682899 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-methyl-6-(2-methylpropylidene)piperazine-2,3,5-trione |
| SMILES | CC(C)C=C1C(=O)NC(=O)C(=O)N1C |
| InChI | InChI=1S/C9H12N2O3/c1-5(2)4-6-7(12)10-8(13)9(14)11(6)3/h4-5H,1-3H3,(H,10,12,13) |
| InChIKey | ILNIEDZGKQKWNQ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|