C11H13FN2O3 — CID 175565481
1-acetyl-3-[(3-fluorocyclobutyl)methylidene]piperazine-2,5-dione (PubChem CID 175565481) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is 1-acetyl-3-[(3-fluorocyclobutyl)methylidene]piperazine-2,5-dione.
| Compound Name | 1-acetyl-3-[(3-fluorocyclobutyl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 175565481 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-acetyl-3-[(3-fluorocyclobutyl)methylidene]piperazine-2,5-dione |
| SMILES | CC(=O)N1CC(=O)NC(=CC2CC(F)C2)C1=O |
| InChI | InChI=1S/C11H13FN2O3/c1-6(15)14-5-10(16)13-9(11(14)17)4-7-2-8(12)3-7/h4,7-8H,2-3,5H2,1H3,(H,13,16) |
| InChIKey | GYSRRPVRJOEEBP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|