C11H16N2O3 — CID 169246554
(6Z)-1-acetyl-6-pentylidenepiperazine-2,5-dione (PubChem CID 169246554) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is (6Z)-1-acetyl-6-pentylidenepiperazine-2,5-dione.
| Compound Name | (6Z)-1-acetyl-6-pentylidenepiperazine-2,5-dione |
|---|---|
| PubChem CID | 169246554 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (6Z)-1-acetyl-6-pentylidenepiperazine-2,5-dione |
| SMILES | CCCC/C=C1/C(=O)NCC(=O)N1C(C)=O |
| InChI | InChI=1S/C11H16N2O3/c1-3-4-5-6-9-11(16)12-7-10(15)13(9)8(2)14/h6H,3-5,7H2,1-2H3,(H,12,16)/b9-6- |
| InChIKey | SDILUEWBVWMGLW-TWGQIWQCSA-N |
| XLogP | 0.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|