C15H24O3 — CID 146684163
5-[(1R,4R)-4-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-2-enoic acid (PubChem CID 146684163) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 5-[(1R,4R)-4-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-2-enoic acid.
| Compound Name | 5-[(1R,4R)-4-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 146684163 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 5-[(1R,4R)-4-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-2-enoic acid |
| SMILES | C=C1C[C@H](O)CC(C)(C)[C@H]1CCC(C)=CC(=O)O |
| InChI | InChI=1S/C15H24O3/c1-10(7-14(17)18)5-6-13-11(2)8-12(16)9-15(13,3)4/h7,12-13,16H,2,5-6,8-9H2,1,3-4H3,(H,17,18)/t12-,13-/m0/s1 |
| InChIKey | ZCXYXOFYJSKIHR-STQMWFEESA-N |
| XLogP | 3.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|