About 3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one
3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one (PubChem CID 146684238) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is 3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one.
Molecular Properties
| Compound Name | 3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one |
| PubChem CID | 146684238 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one |
| SMILES | CCc1c(O)cc([C@@H](C)[C@@H](C)O)oc1=O |
| InChI | InChI=1S/C11H16O4/c1-4-8-9(13)5-10(15-11(8)14)6(2)7(3)12/h5-7,12-13H,4H2,1-3H3/t6-,7+/m0/s1 |
| InChIKey | JZKQRLWNCLOAGQ-NKWVEPMBSA-N |
| XLogP | 1.39 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one?
The IUPAC name of 3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one (CID 146684238) is 3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one.
What is the SMILES notation for 3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one?
The canonical SMILES for 3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one is CCc1c(O)cc([C@@H](C)[C@@H](C)O)oc1=O.
What is the InChIKey of 3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one?
The InChIKey is JZKQRLWNCLOAGQ-NKWVEPMBSA-N. The full InChI is InChI=1S/C11H16O4/c1-4-8-9(13)5-10(15-11(8)14)6(2)7(3)12/h5-7,12-13H,4H2,1-3H3/t6-,7+/m0/s1.
What are the key properties of 3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one?
3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one has a molecular weight of 212.24 g/mol, XLogP of 1.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-hydroxy-6-[(2S,3R)-3-hydroxybutan-2-yl]pyran-2-one is sourced from PubChem (CID 146684238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).