C30H46O3 — CID 146684310
(5R,8R,10S,13R,14R,17R)-8-hydroxy-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,5,6,7,15,16,17-octahydrocyclopenta[a]phenanthrene-3,12-dione (PubChem CID 146684310) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is (5R,8R,10S,13R,14R,17R)-8-hydroxy-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,5,6,7,15,16,17-octahydrocyclopenta[a]phenanthrene-3,12-dione.
| Compound Name | (5R,8R,10S,13R,14R,17R)-8-hydroxy-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,5,6,7,15,16,17-octahydrocyclopenta[a]phenanthrene-3,12-dione |
|---|---|
| PubChem CID | 146684310 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | (5R,8R,10S,13R,14R,17R)-8-hydroxy-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,5,6,7,15,16,17-octahydrocyclopenta[a]phenanthrene-3,12-dione |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CC[C@@]2(C)[C@]3(O)CC[C@H]4C(C)(C)C(=O)CC[C@]4(C)C3=CC(=O)[C@]12C |
| InChI | InChI=1S/C30H46O3/c1-19(2)10-9-11-20(3)21-12-16-28(7)29(21,8)25(32)18-23-27(6)15-14-24(31)26(4,5)22(27)13-17-30(23,28)33/h10,18,20-22,33H,9,11-17H2,1-8H3/t20-,21-,22+,27+,28-,29+,30+/m1/s1 |
| InChIKey | JIXHFAPZVZWJCW-KEELAESXSA-N |
| XLogP | 6.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|