C30H46O3 — CID 163034022
10-hydroxy-4,4,6b,10,11b-pentamethyl-9-(6-methylhept-5-en-2-yl)-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[a]fluorene-3,11-dione (PubChem CID 163034022) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is 10-hydroxy-4,4,6b,10,11b-pentamethyl-9-(6-methylhept-5-en-2-yl)-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[a]fluorene-3,11-dione.
| Compound Name | 10-hydroxy-4,4,6b,10,11b-pentamethyl-9-(6-methylhept-5-en-2-yl)-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[a]fluorene-3,11-dione |
|---|---|
| PubChem CID | 163034022 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | 10-hydroxy-4,4,6b,10,11b-pentamethyl-9-(6-methylhept-5-en-2-yl)-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[a]fluorene-3,11-dione |
| SMILES | CC(C)=CCCC(C)C1CCC2(C)C3=C(C(=O)C2C1(C)O)C1(C)CCC(=O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C30H46O3/c1-18(2)10-9-11-19(3)20-14-16-28(6)21-12-13-22-27(4,5)23(31)15-17-29(22,7)24(21)25(32)26(28)30(20,8)33/h10,19-20,22,26,33H,9,11-17H2,1-8H3 |
| InChIKey | NGHPOLNAZWJUCF-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|