About CID 146695503
CID 146695503 (PubChem CID 146695503) has the molecular formula C4H8BNO
and a molecular weight of 96.93 g/mol.
Molecular Properties
| Compound Name | CID 146695503 |
| PubChem CID | 146695503 |
| Molecular Formula | C4H8BNO |
| Molecular Weight | 96.93 g/mol |
| Exact Mass | 97.07 |
| IUPAC Name | — |
| SMILES | [B]N1CC(OC)C1 |
| InChI | InChI=1S/C4H8BNO/c1-7-4-2-6(5)3-4/h4H,2-3H2,1H3 |
| InChIKey | XGLWIDPGVYEIIO-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.93 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 146695503 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 146695503?
The IUPAC name of CID 146695503 (CID 146695503) is not available.
What is the SMILES notation for CID 146695503?
The canonical SMILES for CID 146695503 is [B]N1CC(OC)C1.
What is the InChIKey of CID 146695503?
The InChIKey is XGLWIDPGVYEIIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8BNO/c1-7-4-2-6(5)3-4/h4H,2-3H2,1H3.
What are the key properties of CID 146695503?
CID 146695503 has a molecular weight of 96.93 g/mol, XLogP of -0.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 146695503 is sourced from PubChem (CID 146695503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).