C23H46N4O3 — CID 177089843
7,19-dimethoxy-13-oxa-1,5,9,17-tetrazatricyclo[15.3.3.35,9]hexacosane (PubChem CID 177089843) has the molecular formula C23H46N4O3 and a molecular weight of 426.65 g/mol. Its IUPAC name is 7,19-dimethoxy-13-oxa-1,5,9,17-tetrazatricyclo[15.3.3.35,9]hexacosane.
| Compound Name | 7,19-dimethoxy-13-oxa-1,5,9,17-tetrazatricyclo[15.3.3.35,9]hexacosane |
|---|---|
| PubChem CID | 177089843 |
| Molecular Formula | C23H46N4O3 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.36 |
| IUPAC Name | 7,19-dimethoxy-13-oxa-1,5,9,17-tetrazatricyclo[15.3.3.35,9]hexacosane |
| SMILES | COC1CN2CCCOCCCN3CCCN(CCCN(CCC2)C1)CC(OC)C3 |
| InChI | InChI=1S/C23H46N4O3/c1-28-22-18-24-8-3-9-25-11-5-13-27(21-23(19-25)29-2)15-7-17-30-16-6-14-26(20-22)12-4-10-24/h22-23H,3-21H2,1-2H3 |
| InChIKey | OJSDVOAXCQUIBV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 40.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |