C16H25N3OS — CID 1467075
1-ethyl-3-[(1S,5S)-9-(furan-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea (PubChem CID 1467075) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is 1-ethyl-3-[(1S,5S)-9-(furan-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea.
| Compound Name | 1-ethyl-3-[(1S,5S)-9-(furan-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
|---|---|
| PubChem CID | 1467075 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-ethyl-3-[(1S,5S)-9-(furan-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
| SMILES | CCNC(=S)NC1C[C@@H]2CCC[C@@H](C1)N2Cc1ccco1 |
| InChI | InChI=1S/C16H25N3OS/c1-2-17-16(21)18-12-9-13-5-3-6-14(10-12)19(13)11-15-7-4-8-20-15/h4,7-8,12-14H,2-3,5-6,9-11H2,1H3,(H2,17,18,21)/t13-,14-/m0/s1 |
| InChIKey | WCUZGPWNLKYWDA-KBPBESRZSA-N |
| XLogP | 2.65 |
| TPSA | 40.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|