C18H29N3OS — CID 1461193
1-(furan-2-ylmethyl)-3-[(1R,5R)-9-(2-methylpropyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea (PubChem CID 1461193) has the molecular formula C18H29N3OS and a molecular weight of 335.52 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[(1R,5R)-9-(2-methylpropyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[(1R,5R)-9-(2-methylpropyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
|---|---|
| PubChem CID | 1461193 |
| Molecular Formula | C18H29N3OS |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[(1R,5R)-9-(2-methylpropyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
| SMILES | CC(C)CN1[C@@H]2CCC[C@@H]1CC(NC(=S)NCc1ccco1)C2 |
| InChI | InChI=1S/C18H29N3OS/c1-13(2)12-21-15-5-3-6-16(21)10-14(9-15)20-18(23)19-11-17-7-4-8-22-17/h4,7-8,13-16H,3,5-6,9-12H2,1-2H3,(H2,19,20,23)/t15-,16-/m1/s1 |
| InChIKey | NIGLMSZHYYYLLX-HZPDHXFCSA-N |
| XLogP | 3.29 |
| TPSA | 40.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|