C33H32F5N3O2 — CID 146718432
5-(3,5-difluorophenyl)-4-[3-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]-1-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]pentan-2-one (PubChem CID 146718432) has the molecular formula C33H32F5N3O2 and a molecular weight of 597.63 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)-4-[3-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]-1-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]pentan-2-one.
| Compound Name | 5-(3,5-difluorophenyl)-4-[3-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]-1-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]pentan-2-one |
|---|---|
| PubChem CID | 146718432 |
| Molecular Formula | C33H32F5N3O2 |
| Molecular Weight | 597.63 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | 5-(3,5-difluorophenyl)-4-[3-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]-1-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]pentan-2-one |
| SMILES | COc1cc(C)c(-c2cccnc2C(CC(=O)Cn2nc(C(F)(F)F)c3c2CCCC3)Cc2cc(F)cc(F)c2)c(C)c1 |
| InChI | InChI=1S/C33H32F5N3O2/c1-19-11-26(43-3)12-20(2)30(19)28-8-6-10-39-31(28)22(13-21-14-23(34)17-24(35)15-21)16-25(42)18-41-29-9-5-4-7-27(29)32(40-41)33(36,37)38/h6,8,10-12,14-15,17,22H,4-5,7,9,13,16,18H2,1-3H3 |
| InChIKey | REKVVEGIXYCNFU-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.63 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |