C27H24ClN3O2S — CID 146721651
4-tert-butyl-N-[3-chloro-4-cyano-2-(8-methylquinolin-5-yl)phenyl]benzenesulfonamide (PubChem CID 146721651) has the molecular formula C27H24ClN3O2S and a molecular weight of 490.03 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-chloro-4-cyano-2-(8-methylquinolin-5-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[3-chloro-4-cyano-2-(8-methylquinolin-5-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 146721651 |
| Molecular Formula | C27H24ClN3O2S |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 4-tert-butyl-N-[3-chloro-4-cyano-2-(8-methylquinolin-5-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ccc(C#N)c2Cl)c2cccnc12 |
| InChI | InChI=1S/C27H24ClN3O2S/c1-17-7-13-21(22-6-5-15-30-26(17)22)24-23(14-8-18(16-29)25(24)28)31-34(32,33)20-11-9-19(10-12-20)27(2,3)4/h5-15,31H,1-4H3 |
| InChIKey | RFCLDJYJUVNWBW-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |