C9H13NO3S — CID 146724875
(3Z,5Z)-4-methyl-7-(methylamino)hepta-3,5-dien-1-yne-1-sulfonic acid (PubChem CID 146724875) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is (3Z,5Z)-4-methyl-7-(methylamino)hepta-3,5-dien-1-yne-1-sulfonic acid.
| Compound Name | (3Z,5Z)-4-methyl-7-(methylamino)hepta-3,5-dien-1-yne-1-sulfonic acid |
|---|---|
| PubChem CID | 146724875 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (3Z,5Z)-4-methyl-7-(methylamino)hepta-3,5-dien-1-yne-1-sulfonic acid |
| SMILES | CNC/C=C\C(C)=C/C#CS(=O)(=O)O |
| InChI | InChI=1S/C9H13NO3S/c1-9(5-3-7-10-2)6-4-8-14(11,12)13/h3,5-6,10H,7H2,1-2H3,(H,11,12,13)/b5-3-,9-6- |
| InChIKey | RGECMEDBNRBJBF-CMJQDITDSA-N |
| XLogP | 0.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|