C8H15NO2S — CID 126636948
(2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid (PubChem CID 126636948) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid.
| Compound Name | (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid |
|---|---|
| PubChem CID | 126636948 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid |
| SMILES | C/C=C(\C=C/CS(=O)O)CNC |
| InChI | InChI=1S/C8H15NO2S/c1-3-8(7-9-2)5-4-6-12(10)11/h3-5,9H,6-7H2,1-2H3,(H,10,11)/b5-4-,8-3+ |
| InChIKey | CRURAFFABZEQEH-UEQFWHKLSA-N |
| XLogP | 0.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|