(2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid

C8H15NO2S — CID 126636948

IUPAC(2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid
SMILESC/C=C(\C=C/CS(=O)O)CNC
InChIInChI=1S/C8H15NO2S/c1-3-8(7-9-2)5-4-6-12(10)11/h3-5,9H,6-7H2,1-2H3,(H,10,11)/b5-4-,8-3+
InChIKeyCRURAFFABZEQEH-UEQFWHKLSA-N
MW189.28 g/mol
LogP0.93
Rot. Bonds5

About (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid

(2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid (PubChem CID 126636948) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid.

Molecular Properties

Compound Name(2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid
PubChem CID126636948
Molecular FormulaC8H15NO2S
Molecular Weight189.28 g/mol
Exact Mass189.08
IUPAC Name(2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid
SMILESC/C=C(\C=C/CS(=O)O)CNC
InChIInChI=1S/C8H15NO2S/c1-3-8(7-9-2)5-4-6-12(10)11/h3-5,9H,6-7H2,1-2H3,(H,10,11)/b5-4-,8-3+
InChIKeyCRURAFFABZEQEH-UEQFWHKLSA-N
XLogP0.93
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.28
LogP ≤ 50.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid?
The IUPAC name of (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid (CID 126636948) is (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid.
What is the SMILES notation for (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid?
The canonical SMILES for (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid is C/C=C(\C=C/CS(=O)O)CNC.
What is the InChIKey of (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid?
The InChIKey is CRURAFFABZEQEH-UEQFWHKLSA-N. The full InChI is InChI=1S/C8H15NO2S/c1-3-8(7-9-2)5-4-6-12(10)11/h3-5,9H,6-7H2,1-2H3,(H,10,11)/b5-4-,8-3+.
What are the key properties of (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid?
(2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid has a molecular weight of 189.28 g/mol, XLogP of 0.93, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinic acid is sourced from PubChem (CID 126636948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).