C9H17NO2S — CID 126637282
(5Z)-8-(methylamino)octa-1,5-diene-4-sulfinic acid (PubChem CID 126637282) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinic acid.
| Compound Name | (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinic acid |
|---|---|
| PubChem CID | 126637282 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinic acid |
| SMILES | C=CCC(/C=C\CCNC)S(=O)O |
| InChI | InChI=1S/C9H17NO2S/c1-3-6-9(13(11)12)7-4-5-8-10-2/h3-4,7,9-10H,1,5-6,8H2,2H3,(H,11,12)/b7-4- |
| InChIKey | CJGVCUZJYNUZNX-DAXSKMNVSA-N |
| XLogP | 1.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|