C15H31F2NO2S — CID 143236213
(Z)-but-2-ene;2,2-difluoro-3-[[(E)-hex-4-en-2-yl]amino]propane-1-sulfinic acid;ethane (PubChem CID 143236213) has the molecular formula C15H31F2NO2S and a molecular weight of 327.48 g/mol. Its IUPAC name is (Z)-but-2-ene;2,2-difluoro-3-[[(E)-hex-4-en-2-yl]amino]propane-1-sulfinic acid;ethane.
| Compound Name | (Z)-but-2-ene;2,2-difluoro-3-[[(E)-hex-4-en-2-yl]amino]propane-1-sulfinic acid;ethane |
|---|---|
| PubChem CID | 143236213 |
| Molecular Formula | C15H31F2NO2S |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | (Z)-but-2-ene;2,2-difluoro-3-[[(E)-hex-4-en-2-yl]amino]propane-1-sulfinic acid;ethane |
| SMILES | C/C=C/CC(C)NCC(F)(F)CS(=O)O.C/C=C\C.CC |
| InChI | InChI=1S/C9H17F2NO2S.C4H8.C2H6/c1-3-4-5-8(2)12-6-9(10,11)7-15(13)14;1-3-4-2;1-2/h3-4,8,12H,5-7H2,1-2H3,(H,13,14);3-4H,1-2H3;1-2H3/b4-3+;4-3-; |
| InChIKey | YZEHCSDQUJCHBO-OHSCNOFNSA-N |
| XLogP | 4.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|