C10H19F3N2O2S — CID 112740829
3,3,3-trifluoro-N,N-dimethyl-2-(pent-4-en-2-ylamino)propane-1-sulfonamide (PubChem CID 112740829) has the molecular formula C10H19F3N2O2S and a molecular weight of 288.34 g/mol. Its IUPAC name is 3,3,3-trifluoro-N,N-dimethyl-2-(pent-4-en-2-ylamino)propane-1-sulfonamide.
| Compound Name | 3,3,3-trifluoro-N,N-dimethyl-2-(pent-4-en-2-ylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 112740829 |
| Molecular Formula | C10H19F3N2O2S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3,3,3-trifluoro-N,N-dimethyl-2-(pent-4-en-2-ylamino)propane-1-sulfonamide |
| SMILES | C=CCC(C)NC(CS(=O)(=O)N(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O2S/c1-5-6-8(2)14-9(10(11,12)13)7-18(16,17)15(3)4/h5,8-9,14H,1,6-7H2,2-4H3 |
| InChIKey | XRBIBJJZMLOYRS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|