C11H20F3N3O2S — CID 120778572
N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide (PubChem CID 120778572) has the molecular formula C11H20F3N3O2S and a molecular weight of 315.36 g/mol. Its IUPAC name is N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide.
| Compound Name | N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide |
|---|---|
| PubChem CID | 120778572 |
| Molecular Formula | C11H20F3N3O2S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide |
| SMILES | C=CCCS(=O)(=O)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C11H20F3N3O2S/c1-2-3-8-20(18,19)16-9-10(11(12,13)14)17-6-4-15-5-7-17/h2,10,15-16H,1,3-9H2 |
| InChIKey | NUZCPRBPNGVRGZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|