C10H17F3N2O2S — CID 154779652
N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide (PubChem CID 154779652) has the molecular formula C10H17F3N2O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide.
| Compound Name | N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide |
|---|---|
| PubChem CID | 154779652 |
| Molecular Formula | C10H17F3N2O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide |
| SMILES | C=CCCS(=O)(=O)NC1CC(NCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H17F3N2O2S/c1-2-3-4-18(16,17)15-9-5-8(6-9)14-7-10(11,12)13/h2,8-9,14-15H,1,3-7H2 |
| InChIKey | AZGUIJVFCMBRCU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|