About N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide
N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide (PubChem CID 154779652) has the molecular formula C10H17F3N2O2S
and a molecular weight of 286.32 g/mol. Its IUPAC name is N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide.
Molecular Properties
| Compound Name | N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide |
| PubChem CID | 154779652 |
| Molecular Formula | C10H17F3N2O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide |
| SMILES | C=CCCS(=O)(=O)NC1CC(NCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H17F3N2O2S/c1-2-3-4-18(16,17)15-9-5-8(6-9)14-7-10(11,12)13/h2,8-9,14-15H,1,3-7H2 |
| InChIKey | AZGUIJVFCMBRCU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide?
The IUPAC name of N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide (CID 154779652) is N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide.
What is the SMILES notation for N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide?
The canonical SMILES for N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide is C=CCCS(=O)(=O)NC1CC(NCC(F)(F)F)C1.
What is the InChIKey of N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide?
The InChIKey is AZGUIJVFCMBRCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O2S/c1-2-3-4-18(16,17)15-9-5-8(6-9)14-7-10(11,12)13/h2,8-9,14-15H,1,3-7H2.
What are the key properties of N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide?
N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide has a molecular weight of 286.32 g/mol, XLogP of 1.16, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,2,2-trifluoroethylamino)cyclobutyl]but-3-ene-1-sulfonamide is sourced from PubChem (CID 154779652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).