C9H17F2NO2S — CID 143236214
2,2-difluoro-3-[[(E)-hex-4-en-2-yl]amino]propane-1-sulfinic acid (PubChem CID 143236214) has the molecular formula C9H17F2NO2S and a molecular weight of 241.30 g/mol. Its IUPAC name is 2,2-difluoro-3-[[(E)-hex-4-en-2-yl]amino]propane-1-sulfinic acid.
| Compound Name | 2,2-difluoro-3-[[(E)-hex-4-en-2-yl]amino]propane-1-sulfinic acid |
|---|---|
| PubChem CID | 143236214 |
| Molecular Formula | C9H17F2NO2S |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2,2-difluoro-3-[[(E)-hex-4-en-2-yl]amino]propane-1-sulfinic acid |
| SMILES | C/C=C/CC(C)NCC(F)(F)CS(=O)O |
| InChI | InChI=1S/C9H17F2NO2S/c1-3-4-5-8(2)12-6-9(10,11)7-15(13)14/h3-4,8,12H,5-7H2,1-2H3,(H,13,14)/b4-3+ |
| InChIKey | YMLXCXHVPFWAJK-ONEGZZNKSA-N |
| XLogP | 1.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|