C10H18FNO2S — CID 143236352
3-(cyclohept-4-en-1-ylamino)-2-fluoropropane-1-sulfinic acid (PubChem CID 143236352) has the molecular formula C10H18FNO2S and a molecular weight of 235.32 g/mol. Its IUPAC name is 3-(cyclohept-4-en-1-ylamino)-2-fluoropropane-1-sulfinic acid.
| Compound Name | 3-(cyclohept-4-en-1-ylamino)-2-fluoropropane-1-sulfinic acid |
|---|---|
| PubChem CID | 143236352 |
| Molecular Formula | C10H18FNO2S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-(cyclohept-4-en-1-ylamino)-2-fluoropropane-1-sulfinic acid |
| SMILES | O=S(O)CC(F)CNC1CCC=CCC1 |
| InChI | InChI=1S/C10H18FNO2S/c11-9(8-15(13)14)7-12-10-5-3-1-2-4-6-10/h1-2,9-10,12H,3-8H2,(H,13,14) |
| InChIKey | JYLRWLKCUPRVBC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|