C8H15NO3S — CID 24820115
2-[[(1S)-cyclohex-2-en-1-yl]amino]ethanesulfonic acid (PubChem CID 24820115) has the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. Its IUPAC name is 2-[[(1S)-cyclohex-2-en-1-yl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(1S)-cyclohex-2-en-1-yl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 24820115 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 2-[[(1S)-cyclohex-2-en-1-yl]amino]ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCN[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C8H15NO3S/c10-13(11,12)7-6-9-8-4-2-1-3-5-8/h2,4,8-9H,1,3,5-7H2,(H,10,11,12)/t8-/m1/s1 |
| InChIKey | QYBHFBWGLSFIEN-MRVPVSSYSA-N |
| XLogP | 0.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|