C13H20FNO2S — CID 143236319
3-(1-cyclohepta-1,3,5-trien-1-ylpropan-2-ylamino)-2-fluoropropane-1-sulfinic acid (PubChem CID 143236319) has the molecular formula C13H20FNO2S and a molecular weight of 273.37 g/mol. Its IUPAC name is 3-(1-cyclohepta-1,3,5-trien-1-ylpropan-2-ylamino)-2-fluoropropane-1-sulfinic acid.
| Compound Name | 3-(1-cyclohepta-1,3,5-trien-1-ylpropan-2-ylamino)-2-fluoropropane-1-sulfinic acid |
|---|---|
| PubChem CID | 143236319 |
| Molecular Formula | C13H20FNO2S |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3-(1-cyclohepta-1,3,5-trien-1-ylpropan-2-ylamino)-2-fluoropropane-1-sulfinic acid |
| SMILES | CC(CC1=CC=CC=CC1)NCC(F)CS(=O)O |
| InChI | InChI=1S/C13H20FNO2S/c1-11(15-9-13(14)10-18(16)17)8-12-6-4-2-3-5-7-12/h2-6,11,13,15H,7-10H2,1H3,(H,16,17) |
| InChIKey | AYCZJVMFVHSOSE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|