C13H20F3NOS — CID 143236303
3-hydroxysulfanyl-N-[1-[4-(trifluoromethyl)cyclohepta-1,3-dien-1-yl]ethyl]propan-1-amine (PubChem CID 143236303) has the molecular formula C13H20F3NOS and a molecular weight of 295.37 g/mol. Its IUPAC name is 3-hydroxysulfanyl-N-[1-[4-(trifluoromethyl)cyclohepta-1,3-dien-1-yl]ethyl]propan-1-amine.
| Compound Name | 3-hydroxysulfanyl-N-[1-[4-(trifluoromethyl)cyclohepta-1,3-dien-1-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 143236303 |
| Molecular Formula | C13H20F3NOS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-hydroxysulfanyl-N-[1-[4-(trifluoromethyl)cyclohepta-1,3-dien-1-yl]ethyl]propan-1-amine |
| SMILES | CC(NCCCSO)C1=CC=C(C(F)(F)F)CCC1 |
| InChI | InChI=1S/C13H20F3NOS/c1-10(17-8-3-9-19-18)11-4-2-5-12(7-6-11)13(14,15)16/h6-7,10,17-18H,2-5,8-9H2,1H3 |
| InChIKey | RYJKENORMIHASM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|