C17H27NO2S — CID 142978519
N-(3-hydroxysulfanylpropyl)-1-[1-(4-methoxyphenyl)ethyl]cyclopentan-1-amine (PubChem CID 142978519) has the molecular formula C17H27NO2S and a molecular weight of 309.48 g/mol. Its IUPAC name is N-(3-hydroxysulfanylpropyl)-1-[1-(4-methoxyphenyl)ethyl]cyclopentan-1-amine.
| Compound Name | N-(3-hydroxysulfanylpropyl)-1-[1-(4-methoxyphenyl)ethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 142978519 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | N-(3-hydroxysulfanylpropyl)-1-[1-(4-methoxyphenyl)ethyl]cyclopentan-1-amine |
| SMILES | COc1ccc(C(C)C2(NCCCSO)CCCC2)cc1 |
| InChI | InChI=1S/C17H27NO2S/c1-14(15-6-8-16(20-2)9-7-15)17(10-3-4-11-17)18-12-5-13-21-19/h6-9,14,18-19H,3-5,10-13H2,1-2H3 |
| InChIKey | AZALSJPAEWKKQC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|