C16H24FNOS — CID 143236237
(E)-1-(4-fluorophenyl)-N-(3-hydroxysulfanylpropyl)-5-methylhex-1-en-3-amine (PubChem CID 143236237) has the molecular formula C16H24FNOS and a molecular weight of 297.44 g/mol. Its IUPAC name is (E)-1-(4-fluorophenyl)-N-(3-hydroxysulfanylpropyl)-5-methylhex-1-en-3-amine.
| Compound Name | (E)-1-(4-fluorophenyl)-N-(3-hydroxysulfanylpropyl)-5-methylhex-1-en-3-amine |
|---|---|
| PubChem CID | 143236237 |
| Molecular Formula | C16H24FNOS |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (E)-1-(4-fluorophenyl)-N-(3-hydroxysulfanylpropyl)-5-methylhex-1-en-3-amine |
| SMILES | CC(C)CC(/C=C/c1ccc(F)cc1)NCCCSO |
| InChI | InChI=1S/C16H24FNOS/c1-13(2)12-16(18-10-3-11-20-19)9-6-14-4-7-15(17)8-5-14/h4-9,13,16,18-19H,3,10-12H2,1-2H3/b9-6+ |
| InChIKey | JVJYODAYMWUNKU-RMKNXTFCSA-N |
| XLogP | 4.44 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|