C20H33NO3S — CID 91420498
3-[[(3R)-1-(4-tert-butylphenyl)-5-methylhex-1-en-3-yl]amino]propane-1-sulfonic acid (PubChem CID 91420498) has the molecular formula C20H33NO3S and a molecular weight of 367.56 g/mol. Its IUPAC name is 3-[[(3R)-1-(4-tert-butylphenyl)-5-methylhex-1-en-3-yl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[(3R)-1-(4-tert-butylphenyl)-5-methylhex-1-en-3-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 91420498 |
| Molecular Formula | C20H33NO3S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 3-[[(3R)-1-(4-tert-butylphenyl)-5-methylhex-1-en-3-yl]amino]propane-1-sulfonic acid |
| SMILES | CC(C)C[C@H](C=Cc1ccc(C(C)(C)C)cc1)NCCCS(=O)(=O)O |
| InChI | InChI=1S/C20H33NO3S/c1-16(2)15-19(21-13-6-14-25(22,23)24)12-9-17-7-10-18(11-8-17)20(3,4)5/h7-12,16,19,21H,6,13-15H2,1-5H3,(H,22,23,24)/t19-/m0/s1 |
| InChIKey | XSCDEVWOHHPZAR-IBGZPJMESA-N |
| XLogP | 4.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|