C16H23BrO3S — CID 171935013
4-[2-(4-bromophenyl)ethenyl]-6-methylheptane-1-sulfonic acid (PubChem CID 171935013) has the molecular formula C16H23BrO3S and a molecular weight of 375.33 g/mol. Its IUPAC name is 4-[2-(4-bromophenyl)ethenyl]-6-methylheptane-1-sulfonic acid.
| Compound Name | 4-[2-(4-bromophenyl)ethenyl]-6-methylheptane-1-sulfonic acid |
|---|---|
| PubChem CID | 171935013 |
| Molecular Formula | C16H23BrO3S |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 4-[2-(4-bromophenyl)ethenyl]-6-methylheptane-1-sulfonic acid |
| SMILES | CC(C)CC(C=Cc1ccc(Br)cc1)CCCS(=O)(=O)O |
| InChI | InChI=1S/C16H23BrO3S/c1-13(2)12-15(4-3-11-21(18,19)20)6-5-14-7-9-16(17)10-8-14/h5-10,13,15H,3-4,11-12H2,1-2H3,(H,18,19,20) |
| InChIKey | MUHMRDYJUQZKFE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|