C16H24BrNO3S — CID 59771729
3-[[(E,3S)-1-(4-bromophenyl)-5-methylhex-1-en-3-yl]amino]propane-1-sulfonic acid (PubChem CID 59771729) has the molecular formula C16H24BrNO3S and a molecular weight of 390.34 g/mol. Its IUPAC name is 3-[[(E,3S)-1-(4-bromophenyl)-5-methylhex-1-en-3-yl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[(E,3S)-1-(4-bromophenyl)-5-methylhex-1-en-3-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59771729 |
| Molecular Formula | C16H24BrNO3S |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 3-[[(E,3S)-1-(4-bromophenyl)-5-methylhex-1-en-3-yl]amino]propane-1-sulfonic acid |
| SMILES | CC(C)C[C@@H](/C=C/c1ccc(Br)cc1)NCCCS(=O)(=O)O |
| InChI | InChI=1S/C16H24BrNO3S/c1-13(2)12-16(18-10-3-11-22(19,20)21)9-6-14-4-7-15(17)8-5-14/h4-9,13,16,18H,3,10-12H2,1-2H3,(H,19,20,21)/b9-6+/t16-/m1/s1 |
| InChIKey | NVDMTJQLDDUFSE-YXMGTMDOSA-N |
| XLogP | 3.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|