C17H26ClNO3S — CID 59771530
3-[[(E,2S)-1-(4-chlorophenyl)-5,5-dimethylhex-3-en-2-yl]amino]propane-1-sulfonic acid (PubChem CID 59771530) has the molecular formula C17H26ClNO3S and a molecular weight of 359.92 g/mol. Its IUPAC name is 3-[[(E,2S)-1-(4-chlorophenyl)-5,5-dimethylhex-3-en-2-yl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[(E,2S)-1-(4-chlorophenyl)-5,5-dimethylhex-3-en-2-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59771530 |
| Molecular Formula | C17H26ClNO3S |
| Molecular Weight | 359.92 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-[[(E,2S)-1-(4-chlorophenyl)-5,5-dimethylhex-3-en-2-yl]amino]propane-1-sulfonic acid |
| SMILES | CC(C)(C)/C=C/[C@H](Cc1ccc(Cl)cc1)NCCCS(=O)(=O)O |
| InChI | InChI=1S/C17H26ClNO3S/c1-17(2,3)10-9-16(19-11-4-12-23(20,21)22)13-14-5-7-15(18)8-6-14/h5-10,16,19H,4,11-13H2,1-3H3,(H,20,21,22)/b10-9+/t16-/m1/s1 |
| InChIKey | CFSXIOITOPIKBE-ZNFPLGDCSA-N |
| XLogP | 3.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.92 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|