C18H29NO4S — CID 59771699
3-[[(E,2S)-1-(4-methoxyphenyl)-5,5-dimethylhex-3-en-2-yl]amino]propane-1-sulfonic acid (PubChem CID 59771699) has the molecular formula C18H29NO4S and a molecular weight of 355.50 g/mol. Its IUPAC name is 3-[[(E,2S)-1-(4-methoxyphenyl)-5,5-dimethylhex-3-en-2-yl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[(E,2S)-1-(4-methoxyphenyl)-5,5-dimethylhex-3-en-2-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59771699 |
| Molecular Formula | C18H29NO4S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 3-[[(E,2S)-1-(4-methoxyphenyl)-5,5-dimethylhex-3-en-2-yl]amino]propane-1-sulfonic acid |
| SMILES | COc1ccc(C[C@@H](/C=C/C(C)(C)C)NCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H29NO4S/c1-18(2,3)11-10-16(19-12-5-13-24(20,21)22)14-15-6-8-17(23-4)9-7-15/h6-11,16,19H,5,12-14H2,1-4H3,(H,20,21,22)/b11-10+/t16-/m1/s1 |
| InChIKey | IHBYYTMQTGQZKU-SIFUEBAJSA-N |
| XLogP | 3.08 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|