C17H26O3S — CID 58052940
(E,5R)-8,8-dimethyl-5-phenylnon-6-ene-1-sulfonic acid (PubChem CID 58052940) has the molecular formula C17H26O3S and a molecular weight of 310.46 g/mol. Its IUPAC name is (E,5R)-8,8-dimethyl-5-phenylnon-6-ene-1-sulfonic acid.
| Compound Name | (E,5R)-8,8-dimethyl-5-phenylnon-6-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 58052940 |
| Molecular Formula | C17H26O3S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (E,5R)-8,8-dimethyl-5-phenylnon-6-ene-1-sulfonic acid |
| SMILES | CC(C)(C)/C=C/[C@@H](CCCCS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C17H26O3S/c1-17(2,3)13-12-16(15-9-5-4-6-10-15)11-7-8-14-21(18,19)20/h4-6,9-10,12-13,16H,7-8,11,14H2,1-3H3,(H,18,19,20)/b13-12+/t16-/m1/s1 |
| InChIKey | SCZHARACWRQEDP-CJTWTEFWSA-N |
| XLogP | 4.43 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|