C10H14ClNO3S — CID 12544213
3-(5-chloro-2-methylanilino)propane-1-sulfonic acid (PubChem CID 12544213) has the molecular formula C10H14ClNO3S and a molecular weight of 263.75 g/mol. Its IUPAC name is 3-(5-chloro-2-methylanilino)propane-1-sulfonic acid.
| Compound Name | 3-(5-chloro-2-methylanilino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 12544213 |
| Molecular Formula | C10H14ClNO3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 3-(5-chloro-2-methylanilino)propane-1-sulfonic acid |
| SMILES | Cc1ccc(Cl)cc1NCCCS(=O)(=O)O |
| InChI | InChI=1S/C10H14ClNO3S/c1-8-3-4-9(11)7-10(8)12-5-2-6-16(13,14)15/h3-4,7,12H,2,5-6H2,1H3,(H,13,14,15) |
| InChIKey | QSXUZPGROGCKLX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|