C16H17ClN2O3S — CID 175806473
2-[2-(5-chloro-2-methylanilino)ethylsulfonyl]benzamide (PubChem CID 175806473) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is 2-[2-(5-chloro-2-methylanilino)ethylsulfonyl]benzamide.
| Compound Name | 2-[2-(5-chloro-2-methylanilino)ethylsulfonyl]benzamide |
|---|---|
| PubChem CID | 175806473 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-[2-(5-chloro-2-methylanilino)ethylsulfonyl]benzamide |
| SMILES | Cc1ccc(Cl)cc1NCCS(=O)(=O)c1ccccc1C(N)=O |
| InChI | InChI=1S/C16H17ClN2O3S/c1-11-6-7-12(17)10-14(11)19-8-9-23(21,22)15-5-3-2-4-13(15)16(18)20/h2-7,10,19H,8-9H2,1H3,(H2,18,20) |
| InChIKey | YBKXLMWMCHMNHO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |