C13H18FNOS — CID 143236220
N-(1-cyclohepta-1,3,4,6-tetraen-1-ylpropan-2-yl)-2-fluoro-3-hydroxysulfanylpropan-1-amine (PubChem CID 143236220) has the molecular formula C13H18FNOS and a molecular weight of 255.36 g/mol. Its IUPAC name is N-(1-cyclohepta-1,3,4,6-tetraen-1-ylpropan-2-yl)-2-fluoro-3-hydroxysulfanylpropan-1-amine.
| Compound Name | N-(1-cyclohepta-1,3,4,6-tetraen-1-ylpropan-2-yl)-2-fluoro-3-hydroxysulfanylpropan-1-amine |
|---|---|
| PubChem CID | 143236220 |
| Molecular Formula | C13H18FNOS |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | N-(1-cyclohepta-1,3,4,6-tetraen-1-ylpropan-2-yl)-2-fluoro-3-hydroxysulfanylpropan-1-amine |
| SMILES | CC(CC1=CC=C=CC=C1)NCC(F)CSO |
| InChI | InChI=1S/C13H18FNOS/c1-11(15-9-13(14)10-17-16)8-12-6-4-2-3-5-7-12/h2,4-7,11,13,15-16H,8-10H2,1H3 |
| InChIKey | HEZKORSSITUNSU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|