About (Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine
(Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine (PubChem CID 143236273) has the molecular formula C17H30FNOS
and a molecular weight of 315.50 g/mol. Its IUPAC name is (Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine.
Molecular Properties
| Compound Name | (Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine |
| PubChem CID | 143236273 |
| Molecular Formula | C17H30FNOS |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | (Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine |
| SMILES | C/C=C\C.C=CCC1=CCCC(NCC(F)CSO)CC1 |
| InChI | InChI=1S/C13H22FNOS.C4H8/c1-2-4-11-5-3-6-13(8-7-11)15-9-12(14)10-17-16;1-3-4-2/h2,5,12-13,15-16H,1,3-4,6-10H2;3-4H,1-2H3/b;4-3- |
| InChIKey | QOLIHVJOCMAQDE-QGAMPUOQSA-N |
| XLogP | 5.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine?
The IUPAC name of (Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine (CID 143236273) is (Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine.
What is the SMILES notation for (Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine?
The canonical SMILES for (Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine is C/C=C\C.C=CCC1=CCCC(NCC(F)CSO)CC1.
What is the InChIKey of (Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine?
The InChIKey is QOLIHVJOCMAQDE-QGAMPUOQSA-N. The full InChI is InChI=1S/C13H22FNOS.C4H8/c1-2-4-11-5-3-6-13(8-7-11)15-9-12(14)10-17-16;1-3-4-2/h2,5,12-13,15-16H,1,3-4,6-10H2;3-4H,1-2H3/b;4-3-.
What are the key properties of (Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine?
(Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine has a molecular weight of 315.50 g/mol, XLogP of 5.15, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;N-(2-fluoro-3-hydroxysulfanylpropyl)-4-prop-2-enylcyclohept-4-en-1-amine is sourced from PubChem (CID 143236273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).