C9H17NO3S — CID 53361980
3-[[(1R)-cyclohex-2-en-1-yl]amino]propane-1-sulfonic acid (PubChem CID 53361980) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 3-[[(1R)-cyclohex-2-en-1-yl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[(1R)-cyclohex-2-en-1-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 53361980 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 3-[[(1R)-cyclohex-2-en-1-yl]amino]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCN[C@H]1C=CCCC1 |
| InChI | InChI=1S/C9H17NO3S/c11-14(12,13)8-4-7-10-9-5-2-1-3-6-9/h2,5,9-10H,1,3-4,6-8H2,(H,11,12,13)/t9-/m0/s1 |
| InChIKey | PJSIWLVSUASYES-VIFPVBQESA-N |
| XLogP | 0.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|