C10H21NO3S — CID 163545476
4-[[(E)-2-methylpent-3-en-2-yl]amino]butane-1-sulfonic acid (PubChem CID 163545476) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is 4-[[(E)-2-methylpent-3-en-2-yl]amino]butane-1-sulfonic acid.
| Compound Name | 4-[[(E)-2-methylpent-3-en-2-yl]amino]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 163545476 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 4-[[(E)-2-methylpent-3-en-2-yl]amino]butane-1-sulfonic acid |
| SMILES | C/C=C/C(C)(C)NCCCCS(=O)(=O)O |
| InChI | InChI=1S/C10H21NO3S/c1-4-7-10(2,3)11-8-5-6-9-15(12,13)14/h4,7,11H,5-6,8-9H2,1-3H3,(H,12,13,14)/b7-4+ |
| InChIKey | FERNUNZRKQIZSF-QPJJXVBHSA-N |
| XLogP | 1.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|