C12H23NOS — CID 143601971
ethane;(2Z)-N-methyl-3-methylsulfinyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine (PubChem CID 143601971) has the molecular formula C12H23NOS and a molecular weight of 229.39 g/mol. Its IUPAC name is ethane;(2Z)-N-methyl-3-methylsulfinyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine.
| Compound Name | ethane;(2Z)-N-methyl-3-methylsulfinyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143601971 |
| Molecular Formula | C12H23NOS |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | ethane;(2Z)-N-methyl-3-methylsulfinyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine |
| SMILES | C=C/C(=C(\C=C/C)CNC)S(C)=O.CC |
| InChI | InChI=1S/C10H17NOS.C2H6/c1-5-7-9(8-11-3)10(6-2)13(4)12;1-2/h5-7,11H,2,8H2,1,3-4H3;1-2H3/b7-5-,10-9-; |
| InChIKey | DJGIPYUNUOUTSA-FJKDQDGBSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|