C14H31NS — CID 143342682
ethane;(Z,2Z)-N-methyl-2-[1-[methyl(methylidene)-λ4-sulfanyl]ethylidene]pent-3-en-1-amine (PubChem CID 143342682) has the molecular formula C14H31NS and a molecular weight of 245.48 g/mol. Its IUPAC name is ethane;(Z,2Z)-N-methyl-2-[1-[methyl(methylidene)-λ4-sulfanyl]ethylidene]pent-3-en-1-amine.
| Compound Name | ethane;(Z,2Z)-N-methyl-2-[1-[methyl(methylidene)-λ4-sulfanyl]ethylidene]pent-3-en-1-amine |
|---|---|
| PubChem CID | 143342682 |
| Molecular Formula | C14H31NS |
| Molecular Weight | 245.48 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | ethane;(Z,2Z)-N-methyl-2-[1-[methyl(methylidene)-λ4-sulfanyl]ethylidene]pent-3-en-1-amine |
| SMILES | C=S(C)/C(C)=C(/C=C\C)CNC.CC.CC |
| InChI | InChI=1S/C10H19NS.2C2H6/c1-6-7-10(8-11-3)9(2)12(4)5;2*1-2/h6-7,11H,4,8H2,1-3,5H3;2*1-2H3/b7-6-,10-9-;; |
| InChIKey | UPGPXBKKABXQNM-JFHYDWJLSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|