C10H19NS — CID 143342683
(Z,2Z)-N-methyl-2-[1-[methyl(methylidene)-λ4-sulfanyl]ethylidene]pent-3-en-1-amine (PubChem CID 143342683) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is (Z,2Z)-N-methyl-2-[1-[methyl(methylidene)-λ4-sulfanyl]ethylidene]pent-3-en-1-amine.
| Compound Name | (Z,2Z)-N-methyl-2-[1-[methyl(methylidene)-λ4-sulfanyl]ethylidene]pent-3-en-1-amine |
|---|---|
| PubChem CID | 143342683 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (Z,2Z)-N-methyl-2-[1-[methyl(methylidene)-λ4-sulfanyl]ethylidene]pent-3-en-1-amine |
| SMILES | C=S(C)/C(C)=C(/C=C\C)CNC |
| InChI | InChI=1S/C10H19NS/c1-6-7-10(8-11-3)9(2)12(4)5/h6-7,11H,4,8H2,1-3,5H3/b7-6-,10-9- |
| InChIKey | AAWNCIYBEFKAKH-HZJYTTRNSA-N |
| XLogP | 2.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|